C15H19ClN4O4S3 — CID 100654352
(2S)-2-(3-chloro-4-methoxy-N-methylsulfonylanilino)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 100654352) has the molecular formula C15H19ClN4O4S3 and a molecular weight of 451.00 g/mol. Its IUPAC name is (2S)-2-(3-chloro-4-methoxy-N-methylsulfonylanilino)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2S)-2-(3-chloro-4-methoxy-N-methylsulfonylanilino)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 100654352 |
| Molecular Formula | C15H19ClN4O4S3 |
| Molecular Weight | 451.00 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | (2S)-2-(3-chloro-4-methoxy-N-methylsulfonylanilino)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCSc1nnc(NC(=O)[C@H](C)N(c2ccc(OC)c(Cl)c2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C15H19ClN4O4S3/c1-5-25-15-19-18-14(26-15)17-13(21)9(2)20(27(4,22)23)10-6-7-12(24-3)11(16)8-10/h6-9H,5H2,1-4H3,(H,17,18,21)/t9-/m0/s1 |
| InChIKey | HULBBCCNCDINTO-VIFPVBQESA-N |
| XLogP | 3.11 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.00 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|