C15H16Cl2N4O3S3 — CID 133261820
2-(3,4-dichloro-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 133261820) has the molecular formula C15H16Cl2N4O3S3 and a molecular weight of 467.43 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 133261820 |
| Molecular Formula | C15H16Cl2N4O3S3 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | C=CCSc1nnc(NC(=O)C(C)N(c2ccc(Cl)c(Cl)c2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C15H16Cl2N4O3S3/c1-4-7-25-15-20-19-14(26-15)18-13(22)9(2)21(27(3,23)24)10-5-6-11(16)12(17)8-10/h4-6,8-9H,1,7H2,2-3H3,(H,18,19,22) |
| InChIKey | GRUBUNCRLCAWRX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|