C16H20N4O3S3 — CID 100727893
(2R)-2-(3-methyl-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 100727893) has the molecular formula C16H20N4O3S3 and a molecular weight of 412.56 g/mol. Its IUPAC name is (2R)-2-(3-methyl-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (2R)-2-(3-methyl-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 100727893 |
| Molecular Formula | C16H20N4O3S3 |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (2R)-2-(3-methyl-N-methylsulfonylanilino)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | C=CCSc1nnc(NC(=O)[C@@H](C)N(c2cccc(C)c2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C16H20N4O3S3/c1-5-9-24-16-19-18-15(25-16)17-14(21)12(3)20(26(4,22)23)13-8-6-7-11(2)10-13/h5-8,10,12H,1,9H2,2-4H3,(H,17,18,21)/t12-/m1/s1 |
| InChIKey | PYJGLRHQHJMDCN-GFCCVEGCSA-N |
| XLogP | 2.92 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|