C18H26N4O3S3 — CID 133184813
2-(3,5-dimethyl-N-methylsulfonylanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 133184813) has the molecular formula C18H26N4O3S3 and a molecular weight of 442.63 g/mol. Its IUPAC name is 2-(3,5-dimethyl-N-methylsulfonylanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2-(3,5-dimethyl-N-methylsulfonylanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 133184813 |
| Molecular Formula | C18H26N4O3S3 |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-(3,5-dimethyl-N-methylsulfonylanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | Cc1cc(C)cc(N(C(C)C(=O)Nc2nnc(SCC(C)C)s2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H26N4O3S3/c1-11(2)10-26-18-21-20-17(27-18)19-16(23)14(5)22(28(6,24)25)15-8-12(3)7-13(4)9-15/h7-9,11,14H,10H2,1-6H3,(H,19,20,23) |
| InChIKey | NHAWCSKLISQFFH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|