C17H23N5O5S3 — CID 100769129
(2S)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 100769129) has the molecular formula C17H23N5O5S3 and a molecular weight of 473.60 g/mol. Its IUPAC name is (2S)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | (2S)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 100769129 |
| Molecular Formula | C17H23N5O5S3 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | (2S)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N([C@@H](C)C(=O)Nc1nnc(SCC(C)C)s1)S(C)(=O)=O |
| InChI | InChI=1S/C17H23N5O5S3/c1-10(2)9-28-17-20-19-16(29-17)18-15(23)12(4)21(30(5,26)27)14-8-13(22(24)25)7-6-11(14)3/h6-8,10,12H,9H2,1-5H3,(H,18,19,23)/t12-/m0/s1 |
| InChIKey | BPNXFGZGPPJJBP-LBPRGKRZSA-N |
| XLogP | 3.30 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|