C17H27N3O5S2 — CID 132665467
N-(2-tert-butylsulfanylethyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)propanamide (PubChem CID 132665467) has the molecular formula C17H27N3O5S2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)propanamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)propanamide |
|---|---|
| PubChem CID | 132665467 |
| Molecular Formula | C17H27N3O5S2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)propanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(C(C)C(=O)NCCSC(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C17H27N3O5S2/c1-12-7-8-14(20(22)23)11-15(12)19(27(6,24)25)13(2)16(21)18-9-10-26-17(3,4)5/h7-8,11,13H,9-10H2,1-6H3,(H,18,21) |
| InChIKey | CKQIKTCVDNAXBY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|