C16H26N2O3S2 — CID 7303925
(2S)-N-(2-tert-butylsulfanylethyl)-2-(N-methylsulfonylanilino)propanamide (PubChem CID 7303925) has the molecular formula C16H26N2O3S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (2S)-N-(2-tert-butylsulfanylethyl)-2-(N-methylsulfonylanilino)propanamide.
| Compound Name | (2S)-N-(2-tert-butylsulfanylethyl)-2-(N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 7303925 |
| Molecular Formula | C16H26N2O3S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2S)-N-(2-tert-butylsulfanylethyl)-2-(N-methylsulfonylanilino)propanamide |
| SMILES | C[C@@H](C(=O)NCCSC(C)(C)C)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H26N2O3S2/c1-13(15(19)17-11-12-22-16(2,3)4)18(23(5,20)21)14-9-7-6-8-10-14/h6-10,13H,11-12H2,1-5H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | DZOAWAHHOFHJGO-ZDUSSCGKSA-N |
| XLogP | 2.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|