C17H25F3N2O3S2 — CID 132667893
N-(2-tert-butylsulfanylethyl)-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide (PubChem CID 132667893) has the molecular formula C17H25F3N2O3S2 and a molecular weight of 426.53 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 132667893 |
| Molecular Formula | C17H25F3N2O3S2 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide |
| SMILES | CC(C(=O)NCCSC(C)(C)C)N(c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H25F3N2O3S2/c1-12(15(23)21-9-10-26-16(2,3)4)22(27(5,24)25)14-8-6-7-13(11-14)17(18,19)20/h6-8,11-12H,9-10H2,1-5H3,(H,21,23) |
| InChIKey | LMUDWFOANBFQMX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|