C19H21F3N2O3S2 — CID 132673780
2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-phenylsulfanylethyl)propanamide (PubChem CID 132673780) has the molecular formula C19H21F3N2O3S2 and a molecular weight of 446.52 g/mol. Its IUPAC name is 2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-phenylsulfanylethyl)propanamide.
| Compound Name | 2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-phenylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 132673780 |
| Molecular Formula | C19H21F3N2O3S2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(2-phenylsulfanylethyl)propanamide |
| SMILES | CC(C(=O)NCCSc1ccccc1)N(c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H21F3N2O3S2/c1-14(18(25)23-11-12-28-17-9-4-3-5-10-17)24(29(2,26)27)16-8-6-7-15(13-16)19(20,21)22/h3-10,13-14H,11-12H2,1-2H3,(H,23,25) |
| InChIKey | XCDBIGFIOHOADZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|