C18H18F3N3O4S — CID 132668719
2-[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanoylamino]benzamide (PubChem CID 132668719) has the molecular formula C18H18F3N3O4S and a molecular weight of 429.42 g/mol. Its IUPAC name is 2-[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanoylamino]benzamide.
| Compound Name | 2-[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 132668719 |
| Molecular Formula | C18H18F3N3O4S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanoylamino]benzamide |
| SMILES | CC(C(=O)Nc1ccccc1C(N)=O)N(c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H18F3N3O4S/c1-11(17(26)23-15-9-4-3-8-14(15)16(22)25)24(29(2,27)28)13-7-5-6-12(10-13)18(19,20)21/h3-11H,1-2H3,(H2,22,25)(H,23,26) |
| InChIKey | GGNVRLHZZSFYRK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |