C19H20F3N3O4S — CID 53286910
2-[4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanoylamino]benzamide (PubChem CID 53286910) has the molecular formula C19H20F3N3O4S and a molecular weight of 443.45 g/mol. Its IUPAC name is 2-[4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanoylamino]benzamide.
| Compound Name | 2-[4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanoylamino]benzamide |
|---|---|
| PubChem CID | 53286910 |
| Molecular Formula | C19H20F3N3O4S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-[4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanoylamino]benzamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)Nc1ccccc1C(N)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3N3O4S/c1-30(28,29)25(14-7-4-6-13(12-14)19(20,21)22)11-5-10-17(26)24-16-9-3-2-8-15(16)18(23)27/h2-4,6-9,12H,5,10-11H2,1H3,(H2,23,27)(H,24,26) |
| InChIKey | JEPRGTXYXSRTPU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |