C18H20F3N3O3S — CID 53286844
4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(pyridin-2-ylmethyl)butanamide (PubChem CID 53286844) has the molecular formula C18H20F3N3O3S and a molecular weight of 415.44 g/mol. Its IUPAC name is 4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(pyridin-2-ylmethyl)butanamide.
| Compound Name | 4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(pyridin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 53286844 |
| Molecular Formula | C18H20F3N3O3S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-(pyridin-2-ylmethyl)butanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)NCc1ccccn1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20F3N3O3S/c1-28(26,27)24(16-8-4-6-14(12-16)18(19,20)21)11-5-9-17(25)23-13-15-7-2-3-10-22-15/h2-4,6-8,10,12H,5,9,11,13H2,1H3,(H,23,25) |
| InChIKey | TXMOCFPYHQFLAD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |