C21H25F3N2O4S — CID 53286709
N-[(2-ethoxyphenyl)methyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide (PubChem CID 53286709) has the molecular formula C21H25F3N2O4S and a molecular weight of 458.50 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide |
|---|---|
| PubChem CID | 53286709 |
| Molecular Formula | C21H25F3N2O4S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide |
| SMILES | CCOc1ccccc1CNC(=O)CCCN(c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C21H25F3N2O4S/c1-3-30-19-11-5-4-8-16(19)15-25-20(27)12-7-13-26(31(2,28)29)18-10-6-9-17(14-18)21(22,23)24/h4-6,8-11,14H,3,7,12-13,15H2,1-2H3,(H,25,27) |
| InChIKey | VCALTOBQOVDXAM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |