C20H22F4N2O3S — CID 53286813
N-[1-(4-fluorophenyl)ethyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide (PubChem CID 53286813) has the molecular formula C20H22F4N2O3S and a molecular weight of 446.47 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide |
|---|---|
| PubChem CID | 53286813 |
| Molecular Formula | C20H22F4N2O3S |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-4-[N-methylsulfonyl-3-(trifluoromethyl)anilino]butanamide |
| SMILES | CC(NC(=O)CCCN(c1cccc(C(F)(F)F)c1)S(C)(=O)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22F4N2O3S/c1-14(15-8-10-17(21)11-9-15)25-19(27)7-4-12-26(30(2,28)29)18-6-3-5-16(13-18)20(22,23)24/h3,5-6,8-11,13-14H,4,7,12H2,1-2H3,(H,25,27) |
| InChIKey | RHXGBSUJHTZPGF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |