C15H21F3N2O3S — CID 113145243
N-(2-methylpropyl)-3-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide (PubChem CID 113145243) has the molecular formula C15H21F3N2O3S and a molecular weight of 366.41 g/mol. Its IUPAC name is N-(2-methylpropyl)-3-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-(2-methylpropyl)-3-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 113145243 |
| Molecular Formula | C15H21F3N2O3S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(2-methylpropyl)-3-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide |
| SMILES | CC(C)CNC(=O)CCN(c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C15H21F3N2O3S/c1-11(2)10-19-14(21)7-8-20(24(3,22)23)13-6-4-5-12(9-13)15(16,17)18/h4-6,9,11H,7-8,10H2,1-3H3,(H,19,21) |
| InChIKey | DJDSPMLGKYCKSJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |