C17H15F3N2O5S — CID 1265964
2-[[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]benzoic acid (PubChem CID 1265964) has the molecular formula C17H15F3N2O5S and a molecular weight of 416.38 g/mol. Its IUPAC name is 2-[[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1265964 |
| Molecular Formula | C17H15F3N2O5S |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-[[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]benzoic acid |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccccc1C(=O)O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N2O5S/c1-28(26,27)22(12-6-4-5-11(9-12)17(18,19)20)10-15(23)21-14-8-3-2-7-13(14)16(24)25/h2-9H,10H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | VYARKLLAQHGQGE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |