C18H19F3N2O3S2 — CID 132669487
N-(2-methylsulfanylphenyl)-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide (PubChem CID 132669487) has the molecular formula C18H19F3N2O3S2 and a molecular weight of 432.49 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-(2-methylsulfanylphenyl)-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 132669487 |
| Molecular Formula | C18H19F3N2O3S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]propanamide |
| SMILES | CSc1ccccc1NC(=O)C(C)N(c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H19F3N2O3S2/c1-12(17(24)22-15-9-4-5-10-16(15)27-2)23(28(3,25)26)14-8-6-7-13(11-14)18(19,20)21/h4-12H,1-3H3,(H,22,24) |
| InChIKey | OSXBJTFKGSPNLJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |