C22H27F3N2O4S — CID 133165316
2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[2-(2-propan-2-ylphenoxy)ethyl]propanamide (PubChem CID 133165316) has the molecular formula C22H27F3N2O4S and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[2-(2-propan-2-ylphenoxy)ethyl]propanamide.
| Compound Name | 2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[2-(2-propan-2-ylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 133165316 |
| Molecular Formula | C22H27F3N2O4S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[2-(2-propan-2-ylphenoxy)ethyl]propanamide |
| SMILES | CC(C)c1ccccc1OCCNC(=O)C(C)N(c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C22H27F3N2O4S/c1-15(2)19-10-5-6-11-20(19)31-13-12-26-21(28)16(3)27(32(4,29)30)18-9-7-8-17(14-18)22(23,24)25/h5-11,14-16H,12-13H2,1-4H3,(H,26,28) |
| InChIKey | NWWIESHEKKYALG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|