C16H24F2N2O3S2 — CID 99131928
(2R)-N-(2-tert-butylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide (PubChem CID 99131928) has the molecular formula C16H24F2N2O3S2 and a molecular weight of 394.51 g/mol. Its IUPAC name is (2R)-N-(2-tert-butylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-(2-tert-butylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 99131928 |
| Molecular Formula | C16H24F2N2O3S2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (2R)-N-(2-tert-butylsulfanylethyl)-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
| SMILES | C[C@H](C(=O)NCCSC(C)(C)C)N(c1ccc(F)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C16H24F2N2O3S2/c1-11(15(21)19-8-9-24-16(2,3)4)20(25(5,22)23)12-6-7-13(17)14(18)10-12/h6-7,10-11H,8-9H2,1-5H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | VMWCXLZNJZHESM-LLVKDONJSA-N |
| XLogP | 2.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|