C20H24F2N2O3S2 — CID 132672533
2-(3,4-difluoro-N-methylsulfonylanilino)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide (PubChem CID 132672533) has the molecular formula C20H24F2N2O3S2 and a molecular weight of 442.55 g/mol. Its IUPAC name is 2-(3,4-difluoro-N-methylsulfonylanilino)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide.
| Compound Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 132672533 |
| Molecular Formula | C20H24F2N2O3S2 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-(3,4-difluoro-N-methylsulfonylanilino)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide |
| SMILES | Cc1ccc(CSCCNC(=O)C(C)N(c2ccc(F)c(F)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H24F2N2O3S2/c1-14-4-6-16(7-5-14)13-28-11-10-23-20(25)15(2)24(29(3,26)27)17-8-9-18(21)19(22)12-17/h4-9,12,15H,10-11,13H2,1-3H3,(H,23,25) |
| InChIKey | LNAQAAYRVSMOKS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|