C21H27F2N3O3S — CID 100660301
(2R)-N-[[4-(diethylamino)phenyl]methyl]-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide (PubChem CID 100660301) has the molecular formula C21H27F2N3O3S and a molecular weight of 439.53 g/mol. Its IUPAC name is (2R)-N-[[4-(diethylamino)phenyl]methyl]-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-[[4-(diethylamino)phenyl]methyl]-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 100660301 |
| Molecular Formula | C21H27F2N3O3S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2R)-N-[[4-(diethylamino)phenyl]methyl]-2-(3,4-difluoro-N-methylsulfonylanilino)propanamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)[C@@H](C)N(c2ccc(F)c(F)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H27F2N3O3S/c1-5-25(6-2)17-9-7-16(8-10-17)14-24-21(27)15(3)26(30(4,28)29)18-11-12-19(22)20(23)13-18/h7-13,15H,5-6,14H2,1-4H3,(H,24,27)/t15-/m1/s1 |
| InChIKey | DRGUTXWAWQBBNB-OAHLLOKOSA-N |
| XLogP | 3.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|