C22H27ClF3N3O3S — CID 100714274
(2S)-2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[[4-(diethylamino)phenyl]methyl]propanamide (PubChem CID 100714274) has the molecular formula C22H27ClF3N3O3S and a molecular weight of 505.99 g/mol. Its IUPAC name is (2S)-2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[[4-(diethylamino)phenyl]methyl]propanamide.
| Compound Name | (2S)-2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[[4-(diethylamino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 100714274 |
| Molecular Formula | C22H27ClF3N3O3S |
| Molecular Weight | 505.99 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | (2S)-2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[[4-(diethylamino)phenyl]methyl]propanamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)[C@H](C)N(c2ccc(Cl)c(C(F)(F)F)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H27ClF3N3O3S/c1-5-28(6-2)17-9-7-16(8-10-17)14-27-21(30)15(3)29(33(4,31)32)18-11-12-20(23)19(13-18)22(24,25)26/h7-13,15H,5-6,14H2,1-4H3,(H,27,30)/t15-/m0/s1 |
| InChIKey | GVBQSHBXTKQYQG-HNNXBMFYSA-N |
| XLogP | 4.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.99 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|