C21H24ClF3N2O4S — CID 133240317
2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[2-(3,5-dimethylphenoxy)ethyl]propanamide (PubChem CID 133240317) has the molecular formula C21H24ClF3N2O4S and a molecular weight of 492.95 g/mol. Its IUPAC name is 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[2-(3,5-dimethylphenoxy)ethyl]propanamide.
| Compound Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[2-(3,5-dimethylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 133240317 |
| Molecular Formula | C21H24ClF3N2O4S |
| Molecular Weight | 492.95 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]-N-[2-(3,5-dimethylphenoxy)ethyl]propanamide |
| SMILES | Cc1cc(C)cc(OCCNC(=O)C(C)N(c2ccc(Cl)c(C(F)(F)F)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H24ClF3N2O4S/c1-13-9-14(2)11-17(10-13)31-8-7-26-20(28)15(3)27(32(4,29)30)16-5-6-19(22)18(12-16)21(23,24)25/h5-6,9-12,15H,7-8H2,1-4H3,(H,26,28) |
| InChIKey | KROVEMIYQRLNFQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.95 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|