C23H31ClN2O4S — CID 125078154
(2R)-N-[2-(4-tert-butylphenoxy)ethyl]-2-(3-chloro-4-methyl-N-methylsulfonylanilino)propanamide (PubChem CID 125078154) has the molecular formula C23H31ClN2O4S and a molecular weight of 467.03 g/mol. Its IUPAC name is (2R)-N-[2-(4-tert-butylphenoxy)ethyl]-2-(3-chloro-4-methyl-N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-[2-(4-tert-butylphenoxy)ethyl]-2-(3-chloro-4-methyl-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 125078154 |
| Molecular Formula | C23H31ClN2O4S |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (2R)-N-[2-(4-tert-butylphenoxy)ethyl]-2-(3-chloro-4-methyl-N-methylsulfonylanilino)propanamide |
| SMILES | Cc1ccc(N([C@H](C)C(=O)NCCOc2ccc(C(C)(C)C)cc2)S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C23H31ClN2O4S/c1-16-7-10-19(15-21(16)24)26(31(6,28)29)17(2)22(27)25-13-14-30-20-11-8-18(9-12-20)23(3,4)5/h7-12,15,17H,13-14H2,1-6H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | CIGGGCOSYYZKNC-QGZVFWFLSA-N |
| XLogP | 4.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|