C22H27Cl2N3O6S2 — CID 133240721
2-(3,4-dichloro-N-methylsulfonylanilino)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]propanamide (PubChem CID 133240721) has the molecular formula C22H27Cl2N3O6S2 and a molecular weight of 564.51 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]propanamide.
| Compound Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 133240721 |
| Molecular Formula | C22H27Cl2N3O6S2 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]propanamide |
| SMILES | CC(C(=O)NCCOc1ccc(S(=O)(=O)N2CCCC2)cc1)N(c1ccc(Cl)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C22H27Cl2N3O6S2/c1-16(27(34(2,29)30)17-5-10-20(23)21(24)15-17)22(28)25-11-14-33-18-6-8-19(9-7-18)35(31,32)26-12-3-4-13-26/h5-10,15-16H,3-4,11-14H2,1-2H3,(H,25,28) |
| InChIKey | RRCZVYLCOSOLHG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|