C25H35N3O6S2 — CID 133244713
2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide (PubChem CID 133244713) has the molecular formula C25H35N3O6S2 and a molecular weight of 537.70 g/mol. Its IUPAC name is 2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide.
| Compound Name | 2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 133244713 |
| Molecular Formula | C25H35N3O6S2 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide |
| SMILES | Cc1ccc(C)c(N(C(C)C(=O)NCCOc2ccc(S(=O)(=O)N3CCCCC3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C25H35N3O6S2/c1-19-8-9-20(2)24(18-19)28(35(4,30)31)21(3)25(29)26-14-17-34-22-10-12-23(13-11-22)36(32,33)27-15-6-5-7-16-27/h8-13,18,21H,5-7,14-17H2,1-4H3,(H,26,29) |
| InChIKey | YSEFWJGOZQKLEO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|