C23H30FN3O6S2 — CID 133234708
2-(2-fluoro-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide (PubChem CID 133234708) has the molecular formula C23H30FN3O6S2 and a molecular weight of 527.64 g/mol. Its IUPAC name is 2-(2-fluoro-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide.
| Compound Name | 2-(2-fluoro-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 133234708 |
| Molecular Formula | C23H30FN3O6S2 |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-(2-fluoro-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide |
| SMILES | CC(C(=O)NCCOc1ccc(S(=O)(=O)N2CCCCC2)cc1)N(c1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C23H30FN3O6S2/c1-18(27(34(2,29)30)22-9-5-4-8-21(22)24)23(28)25-14-17-33-19-10-12-20(13-11-19)35(31,32)26-15-6-3-7-16-26/h4-5,8-13,18H,3,6-7,14-17H2,1-2H3,(H,25,28) |
| InChIKey | CZEBFXXBXMBBIQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|