C23H31N3O6S2 — CID 125072002
(2S)-2-[methyl(methylsulfonyl)amino]-2-phenyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]acetamide (PubChem CID 125072002) has the molecular formula C23H31N3O6S2 and a molecular weight of 509.65 g/mol. Its IUPAC name is (2S)-2-[methyl(methylsulfonyl)amino]-2-phenyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]acetamide.
| Compound Name | (2S)-2-[methyl(methylsulfonyl)amino]-2-phenyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 125072002 |
| Molecular Formula | C23H31N3O6S2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | (2S)-2-[methyl(methylsulfonyl)amino]-2-phenyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]acetamide |
| SMILES | CN([C@H](C(=O)NCCOc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H31N3O6S2/c1-25(33(2,28)29)22(19-9-5-3-6-10-19)23(27)24-15-18-32-20-11-13-21(14-12-20)34(30,31)26-16-7-4-8-17-26/h3,5-6,9-14,22H,4,7-8,15-18H2,1-2H3,(H,24,27)/t22-/m0/s1 |
| InChIKey | VHUFZJSOULIFPH-QFIPXVFZSA-N |
| XLogP | 1.99 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|