C26H37N3O6S2 — CID 133234719
2-(3,5-dimethyl-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]butanamide (PubChem CID 133234719) has the molecular formula C26H37N3O6S2 and a molecular weight of 551.73 g/mol. Its IUPAC name is 2-(3,5-dimethyl-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]butanamide.
| Compound Name | 2-(3,5-dimethyl-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 133234719 |
| Molecular Formula | C26H37N3O6S2 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 2-(3,5-dimethyl-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]butanamide |
| SMILES | CCC(C(=O)NCCOc1ccc(S(=O)(=O)N2CCCCC2)cc1)N(c1cc(C)cc(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C26H37N3O6S2/c1-5-25(29(36(4,31)32)22-18-20(2)17-21(3)19-22)26(30)27-13-16-35-23-9-11-24(12-10-23)37(33,34)28-14-7-6-8-15-28/h9-12,17-19,25H,5-8,13-16H2,1-4H3,(H,27,30) |
| InChIKey | GUXKLJPGVKXROQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|