C23H33N3O6S2 — CID 133240470
2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]butanamide (PubChem CID 133240470) has the molecular formula C23H33N3O6S2 and a molecular weight of 511.67 g/mol. Its IUPAC name is 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]butanamide.
| Compound Name | 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 133240470 |
| Molecular Formula | C23H33N3O6S2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]butanamide |
| SMILES | CCC(C(=O)NCCOc1ccc(S(=O)(=O)N(C)C)cc1)N(c1ccc(C)c(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H33N3O6S2/c1-7-22(26(33(6,28)29)19-9-8-17(2)18(3)16-19)23(27)24-14-15-32-20-10-12-21(13-11-20)34(30,31)25(4)5/h8-13,16,22H,7,14-15H2,1-6H3,(H,24,27) |
| InChIKey | LLYNEVZXLSPAOY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|