C20H26FN3O6S2 — CID 133240541
N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2-(3-fluoro-N-methylsulfonylanilino)propanamide (PubChem CID 133240541) has the molecular formula C20H26FN3O6S2 and a molecular weight of 487.58 g/mol. Its IUPAC name is N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2-(3-fluoro-N-methylsulfonylanilino)propanamide.
| Compound Name | N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2-(3-fluoro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 133240541 |
| Molecular Formula | C20H26FN3O6S2 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-[2-[4-(dimethylsulfamoyl)phenoxy]ethyl]-2-(3-fluoro-N-methylsulfonylanilino)propanamide |
| SMILES | CC(C(=O)NCCOc1ccc(S(=O)(=O)N(C)C)cc1)N(c1cccc(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C20H26FN3O6S2/c1-15(24(31(4,26)27)17-7-5-6-16(21)14-17)20(25)22-12-13-30-18-8-10-19(11-9-18)32(28,29)23(2)3/h5-11,14-15H,12-13H2,1-4H3,(H,22,25) |
| InChIKey | SKNYSWCFPVWBCY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|