C23H30ClN3O6S2 — CID 133244711
2-(3-chloro-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide (PubChem CID 133244711) has the molecular formula C23H30ClN3O6S2 and a molecular weight of 544.10 g/mol. Its IUPAC name is 2-(3-chloro-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide.
| Compound Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 133244711 |
| Molecular Formula | C23H30ClN3O6S2 |
| Molecular Weight | 544.10 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]propanamide |
| SMILES | CC(C(=O)NCCOc1ccc(S(=O)(=O)N2CCCCC2)cc1)N(c1cccc(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C23H30ClN3O6S2/c1-18(27(34(2,29)30)20-8-6-7-19(24)17-20)23(28)25-13-16-33-21-9-11-22(12-10-21)35(31,32)26-14-4-3-5-15-26/h6-12,17-18H,3-5,13-16H2,1-2H3,(H,25,28) |
| InChIKey | RWWBKLPHZCVEGK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.10 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|