C24H33N3O7S2 — CID 133234771
2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]propanamide (PubChem CID 133234771) has the molecular formula C24H33N3O7S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]propanamide.
| Compound Name | 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 133234771 |
| Molecular Formula | C24H33N3O7S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 2-(3,4-dimethyl-N-methylsulfonylanilino)-N-[2-(4-morpholin-4-ylsulfonylphenoxy)ethyl]propanamide |
| SMILES | Cc1ccc(N(C(C)C(=O)NCCOc2ccc(S(=O)(=O)N3CCOCC3)cc2)S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C24H33N3O7S2/c1-18-5-6-21(17-19(18)2)27(35(4,29)30)20(3)24(28)25-11-14-34-22-7-9-23(10-8-22)36(31,32)26-12-15-33-16-13-26/h5-10,17,20H,11-16H2,1-4H3,(H,25,28) |
| InChIKey | DAZZFKYRRTVFFM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|