C24H33N3O7S2 — CID 125071297
(2R)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]propanamide (PubChem CID 125071297) has the molecular formula C24H33N3O7S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is (2R)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]propanamide.
| Compound Name | (2R)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 125071297 |
| Molecular Formula | C24H33N3O7S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | (2R)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]propanamide |
| SMILES | COc1ccc(C)cc1N([C@H](C)C(=O)NCCOc1ccc(S(=O)(=O)N2CCCC2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C24H33N3O7S2/c1-18-7-12-23(33-3)22(17-18)27(35(4,29)30)19(2)24(28)25-13-16-34-20-8-10-21(11-9-20)36(31,32)26-14-5-6-15-26/h7-12,17,19H,5-6,13-16H2,1-4H3,(H,25,28)/t19-/m1/s1 |
| InChIKey | IHHSWNVKQLRVGC-LJQANCHMSA-N |
| XLogP | 2.14 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|