C24H28N2O5S — CID 125086273
(2R)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide (PubChem CID 125086273) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is (2R)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide.
| Compound Name | (2R)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide |
|---|---|
| PubChem CID | 125086273 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (2R)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide |
| SMILES | COc1ccc(C)cc1N([C@H](C)C(=O)NCCOc1ccc2ccccc2c1)S(C)(=O)=O |
| InChI | InChI=1S/C24H28N2O5S/c1-17-9-12-23(30-3)22(15-17)26(32(4,28)29)18(2)24(27)25-13-14-31-21-11-10-19-7-5-6-8-20(19)16-21/h5-12,15-16,18H,13-14H2,1-4H3,(H,25,27)/t18-/m1/s1 |
| InChIKey | VGRQMYNLPJLTIW-GOSISDBHSA-N |
| XLogP | 3.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|