C22H31N3O4S — CID 132670025
2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-[3-(N-methylanilino)propyl]propanamide (PubChem CID 132670025) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is 2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-[3-(N-methylanilino)propyl]propanamide.
| Compound Name | 2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-[3-(N-methylanilino)propyl]propanamide |
|---|---|
| PubChem CID | 132670025 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-(2-methoxy-5-methyl-N-methylsulfonylanilino)-N-[3-(N-methylanilino)propyl]propanamide |
| SMILES | COc1ccc(C)cc1N(C(C)C(=O)NCCCN(C)c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H31N3O4S/c1-17-12-13-21(29-4)20(16-17)25(30(5,27)28)18(2)22(26)23-14-9-15-24(3)19-10-7-6-8-11-19/h6-8,10-13,16,18H,9,14-15H2,1-5H3,(H,23,26) |
| InChIKey | ZRTUMDNFQSZKSJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|