C23H25ClN2O4S — CID 133252039
2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide (PubChem CID 133252039) has the molecular formula C23H25ClN2O4S and a molecular weight of 460.98 g/mol. Its IUPAC name is 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide.
| Compound Name | 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide |
|---|---|
| PubChem CID | 133252039 |
| Molecular Formula | C23H25ClN2O4S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 2-(3-chloro-4-methyl-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide |
| SMILES | Cc1ccc(N(C(C)C(=O)NCCOc2ccc3ccccc3c2)S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C23H25ClN2O4S/c1-16-8-10-20(15-22(16)24)26(31(3,28)29)17(2)23(27)25-12-13-30-21-11-9-18-6-4-5-7-19(18)14-21/h4-11,14-15,17H,12-13H2,1-3H3,(H,25,27) |
| InChIKey | ACIZBAWJOJYCTO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|