C22H22Cl2N2O4S — CID 133220575
2-(3,4-dichloro-N-methylsulfonylanilino)-N-(2-naphthalen-1-yloxyethyl)propanamide (PubChem CID 133220575) has the molecular formula C22H22Cl2N2O4S and a molecular weight of 481.40 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(2-naphthalen-1-yloxyethyl)propanamide.
| Compound Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(2-naphthalen-1-yloxyethyl)propanamide |
|---|---|
| PubChem CID | 133220575 |
| Molecular Formula | C22H22Cl2N2O4S |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(2-naphthalen-1-yloxyethyl)propanamide |
| SMILES | CC(C(=O)NCCOc1cccc2ccccc12)N(c1ccc(Cl)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C22H22Cl2N2O4S/c1-15(26(31(2,28)29)17-10-11-19(23)20(24)14-17)22(27)25-12-13-30-21-9-5-7-16-6-3-4-8-18(16)21/h3-11,14-15H,12-13H2,1-2H3,(H,25,27) |
| InChIKey | DQMJTRYAMUEFBX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|