C24H28N2O6S — CID 133252034
2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide (PubChem CID 133252034) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide.
| Compound Name | 2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide |
|---|---|
| PubChem CID | 133252034 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(2-naphthalen-2-yloxyethyl)propanamide |
| SMILES | COc1ccc(N(C(C)C(=O)NCCOc2ccc3ccccc3c2)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C24H28N2O6S/c1-17(26(33(4,28)29)20-10-12-22(30-2)23(16-20)31-3)24(27)25-13-14-32-21-11-9-18-7-5-6-8-19(18)15-21/h5-12,15-17H,13-14H2,1-4H3,(H,25,27) |
| InChIKey | KDSHHDCNDWIYJG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|