C25H34N4O9S2 — CID 133234734
2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]butanamide (PubChem CID 133234734) has the molecular formula C25H34N4O9S2 and a molecular weight of 598.70 g/mol. Its IUPAC name is 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]butanamide.
| Compound Name | 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 133234734 |
| Molecular Formula | C25H34N4O9S2 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]butanamide |
| SMILES | CCC(C(=O)NCCOc1ccc(S(=O)(=O)N2CCCCC2)cc1)N(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C25H34N4O9S2/c1-4-22(28(39(3,33)34)23-18-19(29(31)32)8-13-24(23)37-2)25(30)26-14-17-38-20-9-11-21(12-10-20)40(35,36)27-15-6-5-7-16-27/h8-13,18,22H,4-7,14-17H2,1-3H3,(H,26,30) |
| InChIKey | VADWUHSSATUUAW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|