C20H31N3O6S2 — CID 133234738
1-methylsulfonyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide (PubChem CID 133234738) has the molecular formula C20H31N3O6S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133234738 |
| Molecular Formula | C20H31N3O6S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 1-methylsulfonyl-N-[2-(4-piperidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)NCCOc2ccc(S(=O)(=O)N3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C20H31N3O6S2/c1-30(25,26)23-14-5-6-17(16-23)20(24)21-11-15-29-18-7-9-19(10-8-18)31(27,28)22-12-3-2-4-13-22/h7-10,17H,2-6,11-16H2,1H3,(H,21,24) |
| InChIKey | CHIUCAKVDBPZLL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|