C21H25BrN2O5S — CID 24637927
1-(4-bromophenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]piperidine-3-carboxamide (PubChem CID 24637927) has the molecular formula C21H25BrN2O5S and a molecular weight of 497.41 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-bromophenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24637927 |
| Molecular Formula | C21H25BrN2O5S |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-N-[2-(4-methoxyphenoxy)ethyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)C2CCCN(S(=O)(=O)c3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C21H25BrN2O5S/c1-28-18-6-8-19(9-7-18)29-14-12-23-21(25)16-3-2-13-24(15-16)30(26,27)20-10-4-17(22)5-11-20/h4-11,16H,2-3,12-15H2,1H3,(H,23,25) |
| InChIKey | UDGWAGALEMUGFF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|