C20H32N4O6S2 — CID 133240658
1-(dimethylsulfamoyl)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide (PubChem CID 133240658) has the molecular formula C20H32N4O6S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 1-(dimethylsulfamoyl)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(dimethylsulfamoyl)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133240658 |
| Molecular Formula | C20H32N4O6S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 1-(dimethylsulfamoyl)-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC(C(=O)NCCOc2ccc(S(=O)(=O)N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C20H32N4O6S2/c1-22(2)32(28,29)24-14-5-6-17(16-24)20(25)21-11-15-30-18-7-9-19(10-8-18)31(26,27)23-12-3-4-13-23/h7-10,17H,3-6,11-16H2,1-2H3,(H,21,25) |
| InChIKey | IBWPMWLJXRVZPA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|