C11H23N3O4S — CID 28955789
(3R)-1-(dimethylsulfamoyl)-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 28955789) has the molecular formula C11H23N3O4S and a molecular weight of 293.39 g/mol. Its IUPAC name is (3R)-1-(dimethylsulfamoyl)-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(dimethylsulfamoyl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28955789 |
| Molecular Formula | C11H23N3O4S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (3R)-1-(dimethylsulfamoyl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C11H23N3O4S/c1-13(2)19(16,17)14-7-4-5-10(9-14)11(15)12-6-8-18-3/h10H,4-9H2,1-3H3,(H,12,15)/t10-/m1/s1 |
| InChIKey | GUIKHZVHYFNCER-SNVBAGLBSA-N |
| XLogP | -0.73 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|