C13H25N3O4S — CID 5058959
N-(2-methoxyethyl)-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide (PubChem CID 5058959) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 5058959 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-(2-methoxyethyl)-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1CCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C13H25N3O4S/c1-20-11-6-14-13(17)12-4-9-16(10-5-12)21(18,19)15-7-2-3-8-15/h12H,2-11H2,1H3,(H,14,17) |
| InChIKey | LCSCGHUBYWNKGY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|