C21H40N4O3S — CID 3236692
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide (PubChem CID 3236692) has the molecular formula C21H40N4O3S and a molecular weight of 428.64 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3236692 |
| Molecular Formula | C21H40N4O3S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)C2CCN(S(=O)(=O)N3CCCCC3)CC2)C1 |
| InChI | InChI=1S/C21H40N4O3S/c1-18-15-19(2)17-23(16-18)10-6-9-22-21(26)20-7-13-25(14-8-20)29(27,28)24-11-4-3-5-12-24/h18-20H,3-17H2,1-2H3,(H,22,26) |
| InChIKey | HROCBIHWAKTJDV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|