C22H34FN3O3S — CID 55781972
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 55781972) has the molecular formula C22H34FN3O3S and a molecular weight of 439.60 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55781972 |
| Molecular Formula | C22H34FN3O3S |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)C2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C22H34FN3O3S/c1-17-14-18(2)16-25(15-17)11-3-10-24-22(27)19-8-12-26(13-9-19)30(28,29)21-6-4-20(23)5-7-21/h4-7,17-19H,3,8-16H2,1-2H3,(H,24,27) |
| InChIKey | LXZJOEKYYOKNTO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|