C22H35N3O3S — CID 100650018
1-(4-methylphenyl)sulfonyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide (PubChem CID 100650018) has the molecular formula C22H35N3O3S and a molecular weight of 421.61 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100650018 |
| Molecular Formula | C22H35N3O3S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)NCCCN3CCC[C@@H](C)C3)CC2)cc1 |
| InChI | InChI=1S/C22H35N3O3S/c1-18-6-8-21(9-7-18)29(27,28)25-15-10-20(11-16-25)22(26)23-12-4-14-24-13-3-5-19(2)17-24/h6-9,19-20H,3-5,10-17H2,1-2H3,(H,23,26)/t19-/m1/s1 |
| InChIKey | CYPMXRJOAMAJCS-LJQANCHMSA-N |
| XLogP | 2.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|