C20H30ClN3O3S — CID 42961781
2-chloro-N-[3-(3-methylpiperidin-1-yl)propyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 42961781) has the molecular formula C20H30ClN3O3S and a molecular weight of 428.00 g/mol. Its IUPAC name is 2-chloro-N-[3-(3-methylpiperidin-1-yl)propyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[3-(3-methylpiperidin-1-yl)propyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 42961781 |
| Molecular Formula | C20H30ClN3O3S |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-chloro-N-[3-(3-methylpiperidin-1-yl)propyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CC1CCCN(CCCNC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Cl)C1 |
| InChI | InChI=1S/C20H30ClN3O3S/c1-16-6-4-10-23(15-16)11-5-9-22-20(25)18-14-17(7-8-19(18)21)28(26,27)24-12-2-3-13-24/h7-8,14,16H,2-6,9-13,15H2,1H3,(H,22,25) |
| InChIKey | CMMSCIVWPAJACM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|