C15H21ClN2O4S — CID 78795839
2-chloro-N-(3-hydroxypropyl)-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 78795839) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is 2-chloro-N-(3-hydroxypropyl)-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(3-hydroxypropyl)-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 78795839 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-chloro-N-(3-hydroxypropyl)-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCCO)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C15H21ClN2O4S/c16-14-6-5-12(11-13(14)15(20)17-7-4-10-19)23(21,22)18-8-2-1-3-9-18/h5-6,11,19H,1-4,7-10H2,(H,17,20) |
| InChIKey | PVEUCUNKASPBOI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|